C14H24O2 — CID 23346562
1-(3-hydroxybut-1-ynyl)-2,2,3,6-tetramethylcyclohexan-1-ol (PubChem CID 23346562) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(3-hydroxybut-1-ynyl)-2,2,3,6-tetramethylcyclohexan-1-ol.
| Compound Name | 1-(3-hydroxybut-1-ynyl)-2,2,3,6-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 23346562 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(3-hydroxybut-1-ynyl)-2,2,3,6-tetramethylcyclohexan-1-ol |
| SMILES | CC(O)C#CC1(O)C(C)CCC(C)C1(C)C |
| InChI | InChI=1S/C14H24O2/c1-10-6-7-11(2)14(16,13(10,4)5)9-8-12(3)15/h10-12,15-16H,6-7H2,1-5H3 |
| InChIKey | AUAXFZCTDGYJML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|