C8H4Br4Cl2 — CID 23347067
1,4-dibromo-2,3-bis(bromomethyl)-5,6-dichlorobenzene (PubChem CID 23347067) has the molecular formula C8H4Br4Cl2 and a molecular weight of 490.64 g/mol. Its IUPAC name is 1,4-dibromo-2,3-bis(bromomethyl)-5,6-dichlorobenzene.
| Compound Name | 1,4-dibromo-2,3-bis(bromomethyl)-5,6-dichlorobenzene |
|---|---|
| PubChem CID | 23347067 |
| Molecular Formula | C8H4Br4Cl2 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 485.64 |
| IUPAC Name | 1,4-dibromo-2,3-bis(bromomethyl)-5,6-dichlorobenzene |
| SMILES | Clc1c(Cl)c(Br)c(CBr)c(CBr)c1Br |
| InChI | InChI=1S/C8H4Br4Cl2/c9-1-3-4(2-10)6(12)8(14)7(13)5(3)11/h1-2H2 |
| InChIKey | SWPQDKOSMUFXLU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|