C27H33NO5 — CID 23352653
2-[2-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl]naphthalen-1-yl]acetic acid (PubChem CID 23352653) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-[2-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl]naphthalen-1-yl]acetic acid.
| Compound Name | 2-[2-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl]naphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 23352653 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[2-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl]naphthalen-1-yl]acetic acid |
| SMILES | O=C(O)Cc1c(CCCCCCNCC(O)c2ccc(O)c(CO)c2)ccc2ccccc12 |
| InChI | InChI=1S/C27H33NO5/c29-18-22-15-21(12-13-25(22)30)26(31)17-28-14-6-2-1-3-7-20-11-10-19-8-4-5-9-23(19)24(20)16-27(32)33/h4-5,8-13,15,26,28-31H,1-3,6-7,14,16-18H2,(H,32,33) |
| InChIKey | IRGXAABEIWIMLQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|