C11H5IN2O7 — CID 23357741
3-iodosyl-4,5-dinitronaphthalene-2-carboxylic acid (PubChem CID 23357741) has the molecular formula C11H5IN2O7 and a molecular weight of 404.07 g/mol. Its IUPAC name is 3-iodosyl-4,5-dinitronaphthalene-2-carboxylic acid.
| Compound Name | 3-iodosyl-4,5-dinitronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 23357741 |
| Molecular Formula | C11H5IN2O7 |
| Molecular Weight | 404.07 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | 3-iodosyl-4,5-dinitronaphthalene-2-carboxylic acid |
| SMILES | O=Ic1c(C(=O)O)cc2cccc([N+](=O)[O-])c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H5IN2O7/c15-11(16)6-4-5-2-1-3-7(13(18)19)8(5)10(14(20)21)9(6)12-17/h1-4H,(H,15,16) |
| InChIKey | JYMAASSQZASHEI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|