C16H23ClN2O — CID 23373084
2-(5-butoxy-4-chloro-1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 23373084) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-(5-butoxy-4-chloro-1H-indol-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5-butoxy-4-chloro-1H-indol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23373084 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(5-butoxy-4-chloro-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | CCCCOc1ccc2[nH]cc(CCN(C)C)c2c1Cl |
| InChI | InChI=1S/C16H23ClN2O/c1-4-5-10-20-14-7-6-13-15(16(14)17)12(11-18-13)8-9-19(2)3/h6-7,11,18H,4-5,8-10H2,1-3H3 |
| InChIKey | OGFICQMJPKGDPF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|