C18H16F3N3O2S — CID 2337322
(2S)-7,7-dimethyl-2-phenyl-2-(trifluoromethyl)-6,8-dihydro-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazole-4,9-dione (PubChem CID 2337322) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is (2S)-7,7-dimethyl-2-phenyl-2-(trifluoromethyl)-6,8-dihydro-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazole-4,9-dione.
| Compound Name | (2S)-7,7-dimethyl-2-phenyl-2-(trifluoromethyl)-6,8-dihydro-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazole-4,9-dione |
|---|---|
| PubChem CID | 2337322 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (2S)-7,7-dimethyl-2-phenyl-2-(trifluoromethyl)-6,8-dihydro-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazole-4,9-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N1C(=O)N[C@](c3ccccc3)(C(F)(F)F)N=C1S2 |
| InChI | InChI=1S/C18H16F3N3O2S/c1-16(2)8-11-13(12(25)9-16)27-15-23-17(18(19,20)21,22-14(26)24(11)15)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | VXWLOPDFLUHFRU-KRWDZBQOSA-N |
| XLogP | 4.13 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |