C16H26O3 — CID 23381997
oxan-2-yl 2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 23381997) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is oxan-2-yl 2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | oxan-2-yl 2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 23381997 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | oxan-2-yl 2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | CC1C2CC(CC(=O)OC3CCCCO3)C(C2)C1C |
| InChI | InChI=1S/C16H26O3/c1-10-11(2)14-8-12(10)7-13(14)9-15(17)19-16-5-3-4-6-18-16/h10-14,16H,3-9H2,1-2H3 |
| InChIKey | ASGKLLKTIFHFDN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |