C25H32N4O8 — CID 23382007
2-cyanoethyl 2-[[2-(2-cyanoethoxymethyl)-3-(2-isocyanoethoxy)-2-[2-(2-isocyanoethoxycarbonyl)prop-2-enoxymethyl]propoxy]methyl]prop-2-enoate (PubChem CID 23382007) has the molecular formula C25H32N4O8 and a molecular weight of 516.55 g/mol. Its IUPAC name is 2-cyanoethyl 2-[[2-(2-cyanoethoxymethyl)-3-(2-isocyanoethoxy)-2-[2-(2-isocyanoethoxycarbonyl)prop-2-enoxymethyl]propoxy]methyl]prop-2-enoate.
| Compound Name | 2-cyanoethyl 2-[[2-(2-cyanoethoxymethyl)-3-(2-isocyanoethoxy)-2-[2-(2-isocyanoethoxycarbonyl)prop-2-enoxymethyl]propoxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 23382007 |
| Molecular Formula | C25H32N4O8 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-cyanoethyl 2-[[2-(2-cyanoethoxymethyl)-3-(2-isocyanoethoxy)-2-[2-(2-isocyanoethoxycarbonyl)prop-2-enoxymethyl]propoxy]methyl]prop-2-enoate |
| SMILES | [C-]#[N+]CCOCC(COCCC#N)(COCC(=C)C(=O)OCCC#N)COCC(=C)C(=O)OCC[N+]#[C-] |
| InChI | InChI=1S/C25H32N4O8/c1-21(23(30)36-12-6-8-27)15-34-19-25(17-32-11-5-7-26,18-33-13-9-28-3)20-35-16-22(2)24(31)37-14-10-29-4/h1-2,5-6,9-20H2 |
| InChIKey | MALKAVKUOJEHFW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|