C28H29BrN2O6S — CID 23385665
methyl (2S)-6-amino-2-[(4-bromophenyl)sulfonyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate (PubChem CID 23385665) has the molecular formula C28H29BrN2O6S and a molecular weight of 601.52 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[(4-bromophenyl)sulfonyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[(4-bromophenyl)sulfonyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 23385665 |
| Molecular Formula | C28H29BrN2O6S |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | methyl (2S)-6-amino-2-[(4-bromophenyl)sulfonyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)N(C(=O)OCC1c2ccccc2-c2ccccc21)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H29BrN2O6S/c1-36-27(32)26(12-6-7-17-30)31(38(34,35)20-15-13-19(29)14-16-20)28(33)37-18-25-23-10-4-2-8-21(23)22-9-3-5-11-24(22)25/h2-5,8-11,13-16,25-26H,6-7,12,17-18,30H2,1H3/t26-/m0/s1 |
| InChIKey | WRRLNISEBAQCMH-SANMLTNESA-N |
| XLogP | 5.06 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|