C35H39N2O6S+ — CID 23385671
[(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-benzyl-(4-methylphenyl)sulfonyl-phenylmethoxycarbonylazanium (PubChem CID 23385671) has the molecular formula C35H39N2O6S+ and a molecular weight of 615.77 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-benzyl-(4-methylphenyl)sulfonyl-phenylmethoxycarbonylazanium.
| Compound Name | [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-benzyl-(4-methylphenyl)sulfonyl-phenylmethoxycarbonylazanium |
|---|---|
| PubChem CID | 23385671 |
| Molecular Formula | C35H39N2O6S+ |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-benzyl-(4-methylphenyl)sulfonyl-phenylmethoxycarbonylazanium |
| SMILES | Cc1ccc(S(=O)(=O)[N+](Cc2ccccc2)(C(=O)OCc2ccccc2)[C@@H](CCCCN)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H39N2O6S/c1-28-20-22-32(23-21-28)44(40,41)37(25-29-13-5-2-6-14-29,35(39)43-27-31-17-9-4-10-18-31)33(19-11-12-24-36)34(38)42-26-30-15-7-3-8-16-30/h2-10,13-18,20-23,33H,11-12,19,24-27,36H2,1H3/q+1/t33-,37?/m0/s1 |
| InChIKey | KZNAMHAVOSWURL-AYZYUMGXSA-N |
| XLogP | 6.28 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|