C32H37N2O6S+ — CID 23385673
[(1S)-5-amino-1-carboxypentyl]-(cyclopropylmethyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(4-methylphenyl)sulfonylazanium (PubChem CID 23385673) has the molecular formula C32H37N2O6S+ and a molecular weight of 577.72 g/mol. Its IUPAC name is [(1S)-5-amino-1-carboxypentyl]-(cyclopropylmethyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(4-methylphenyl)sulfonylazanium.
| Compound Name | [(1S)-5-amino-1-carboxypentyl]-(cyclopropylmethyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(4-methylphenyl)sulfonylazanium |
|---|---|
| PubChem CID | 23385673 |
| Molecular Formula | C32H37N2O6S+ |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | [(1S)-5-amino-1-carboxypentyl]-(cyclopropylmethyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(4-methylphenyl)sulfonylazanium |
| SMILES | Cc1ccc(S(=O)(=O)[N+](CC2CC2)(C(=O)OCC2c3ccccc3-c3ccccc32)[C@H](CCCCN)C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N2O6S/c1-22-13-17-24(18-14-22)41(38,39)34(20-23-15-16-23,30(31(35)36)12-6-7-19-33)32(37)40-21-29-27-10-4-2-8-25(27)26-9-3-5-11-28(26)29/h2-5,8-11,13-14,17-18,23,29-30H,6-7,12,15-16,19-21,33H2,1H3/p+1/t30-,34?/m1/s1 |
| InChIKey | PKVOJQCFJSBADI-AMLLJQFGSA-O |
| XLogP | 5.44 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|