C31H37N2O6S+ — CID 23385739
[(1S)-5-amino-1-carboxypentyl]-(benzenesulfonyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(2-methylpropyl)azanium (PubChem CID 23385739) has the molecular formula C31H37N2O6S+ and a molecular weight of 565.71 g/mol. Its IUPAC name is [(1S)-5-amino-1-carboxypentyl]-(benzenesulfonyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(2-methylpropyl)azanium.
| Compound Name | [(1S)-5-amino-1-carboxypentyl]-(benzenesulfonyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 23385739 |
| Molecular Formula | C31H37N2O6S+ |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [(1S)-5-amino-1-carboxypentyl]-(benzenesulfonyl)-(9H-fluoren-9-ylmethoxycarbonyl)-(2-methylpropyl)azanium |
| SMILES | CC(C)C[N+](C(=O)OCC1c2ccccc2-c2ccccc21)([C@@H](CCCCN)C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O6S/c1-22(2)20-33(29(30(34)35)18-10-11-19-32,40(37,38)23-12-4-3-5-13-23)31(36)39-21-28-26-16-8-6-14-24(26)25-15-7-9-17-27(25)28/h3-9,12-17,22,28-29H,10-11,18-21,32H2,1-2H3/p+1/t29-,33?/m0/s1 |
| InChIKey | TTYJPUDMAUMFHW-WXTKOERCSA-O |
| XLogP | 5.38 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|