C35H41N2O6S+ — CID 23385679
[(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-(2-methylpropyl)-naphthalen-1-ylsulfonyl-phenylmethoxycarbonylazanium (PubChem CID 23385679) has the molecular formula C35H41N2O6S+ and a molecular weight of 617.79 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-(2-methylpropyl)-naphthalen-1-ylsulfonyl-phenylmethoxycarbonylazanium.
| Compound Name | [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-(2-methylpropyl)-naphthalen-1-ylsulfonyl-phenylmethoxycarbonylazanium |
|---|---|
| PubChem CID | 23385679 |
| Molecular Formula | C35H41N2O6S+ |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-phenylmethoxyhexan-2-yl]-(2-methylpropyl)-naphthalen-1-ylsulfonyl-phenylmethoxycarbonylazanium |
| SMILES | CC(C)C[N+](C(=O)OCc1ccccc1)([C@@H](CCCCN)C(=O)OCc1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C35H41N2O6S/c1-27(2)24-37(35(39)43-26-29-16-7-4-8-17-29,44(40,41)33-22-13-19-30-18-9-10-20-31(30)33)32(21-11-12-23-36)34(38)42-25-28-14-5-3-6-15-28/h3-10,13-20,22,27,32H,11-12,21,23-26,36H2,1-2H3/q+1/t32-,37?/m0/s1 |
| InChIKey | UFYOMUBACJDUBS-XRRNFBIGSA-N |
| XLogP | 6.58 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|