C21H28ClNO6 — CID 23387569
chloromethyl 4-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxycyclohexane-1-carboxylate (PubChem CID 23387569) has the molecular formula C21H28ClNO6 and a molecular weight of 425.91 g/mol. Its IUPAC name is chloromethyl 4-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxycyclohexane-1-carboxylate.
| Compound Name | chloromethyl 4-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23387569 |
| Molecular Formula | C21H28ClNO6 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | chloromethyl 4-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxycyclohexane-1-carboxylate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC1CCC(C(=O)OCCl)CC1 |
| InChI | InChI=1S/C21H28ClNO6/c1-14(2)18(23-21(26)27-12-15-6-4-3-5-7-15)20(25)29-17-10-8-16(9-11-17)19(24)28-13-22/h3-7,14,16-18H,8-13H2,1-2H3,(H,23,26)/t16?,17?,18-/m0/s1 |
| InChIKey | IOUDMGPBIRDKMH-ABHNRTSZSA-N |
| XLogP | 3.78 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|