About 3-methylbutan-2-one;yttrium(3+)
3-methylbutan-2-one;yttrium(3+) (PubChem CID 23390008) has the molecular formula C5H9OY+2
and a molecular weight of 174.03 g/mol. Its IUPAC name is 3-methylbutan-2-one;yttrium(3+).
Molecular Properties
| Compound Name | 3-methylbutan-2-one;yttrium(3+) |
| PubChem CID | 23390008 |
| Molecular Formula | C5H9OY+2 |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | 3-methylbutan-2-one;yttrium(3+) |
| SMILES | CC(=O)[C-](C)C.[Y+3] |
| InChI | InChI=1S/C5H9O.Y/c1-4(2)5(3)6;/h1-3H3;/q-1;+3 |
| InChIKey | IMOHOQBJFOFAAX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-one;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-one;yttrium(3+)?
The IUPAC name of 3-methylbutan-2-one;yttrium(3+) (CID 23390008) is 3-methylbutan-2-one;yttrium(3+).
What is the SMILES notation for 3-methylbutan-2-one;yttrium(3+)?
The canonical SMILES for 3-methylbutan-2-one;yttrium(3+) is CC(=O)[C-](C)C.[Y+3].
What is the InChIKey of 3-methylbutan-2-one;yttrium(3+)?
The InChIKey is IMOHOQBJFOFAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O.Y/c1-4(2)5(3)6;/h1-3H3;/q-1;+3.
What are the key properties of 3-methylbutan-2-one;yttrium(3+)?
3-methylbutan-2-one;yttrium(3+) has a molecular weight of 174.03 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-one;yttrium(3+) is sourced from PubChem (CID 23390008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).