C10H9F5O — CID 23391432
2,6-difluoro-4-(2,3,3-trifluorobutan-2-yl)phenol (PubChem CID 23391432) has the molecular formula C10H9F5O and a molecular weight of 240.17 g/mol. Its IUPAC name is 2,6-difluoro-4-(2,3,3-trifluorobutan-2-yl)phenol.
| Compound Name | 2,6-difluoro-4-(2,3,3-trifluorobutan-2-yl)phenol |
|---|---|
| PubChem CID | 23391432 |
| Molecular Formula | C10H9F5O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2,6-difluoro-4-(2,3,3-trifluorobutan-2-yl)phenol |
| SMILES | CC(F)(F)C(C)(F)c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C10H9F5O/c1-9(13,10(2,14)15)5-3-6(11)8(16)7(12)4-5/h3-4,16H,1-2H3 |
| InChIKey | SDFDUEPQNPCCCB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |