C27H33N5O3 — CID 23392362
4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide (PubChem CID 23392362) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 23392362 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(C(=O)NCCCN3CCN(c4ncccn4)CC3)cc2)C1 |
| InChI | InChI=1S/C27H33N5O3/c1-20-16-23-19-35-25(34)27(23,17-20)18-21-4-6-22(7-5-21)24(33)28-10-3-11-31-12-14-32(15-13-31)26-29-8-2-9-30-26/h2,4-9,23H,1,3,10-19H2,(H,28,33) |
| InChIKey | ATGCHJFEZIDLTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|