C20H38N2O4 — CID 23393718
2-hydroxy-3-(2-methylpentanoylamino)-N-(2-oxohexan-3-yl)octanamide (PubChem CID 23393718) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-hydroxy-3-(2-methylpentanoylamino)-N-(2-oxohexan-3-yl)octanamide.
| Compound Name | 2-hydroxy-3-(2-methylpentanoylamino)-N-(2-oxohexan-3-yl)octanamide |
|---|---|
| PubChem CID | 23393718 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 2-hydroxy-3-(2-methylpentanoylamino)-N-(2-oxohexan-3-yl)octanamide |
| SMILES | CCCCCC(NC(=O)C(C)CCC)C(O)C(=O)NC(CCC)C(C)=O |
| InChI | InChI=1S/C20H38N2O4/c1-6-9-10-13-17(22-19(25)14(4)11-7-2)18(24)20(26)21-16(12-8-3)15(5)23/h14,16-18,24H,6-13H2,1-5H3,(H,21,26)(H,22,25) |
| InChIKey | AQCRHXFCQHYPEM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|