C7H16ClNO3 — CID 23396804
2-[(3-chloro-2-hydroxypropyl)amino]butane-1,4-diol (PubChem CID 23396804) has the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]butane-1,4-diol.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]butane-1,4-diol |
|---|---|
| PubChem CID | 23396804 |
| Molecular Formula | C7H16ClNO3 |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]butane-1,4-diol |
| SMILES | OCCC(CO)NCC(O)CCl |
| InChI | InChI=1S/C7H16ClNO3/c8-3-7(12)4-9-6(5-11)1-2-10/h6-7,9-12H,1-5H2 |
| InChIKey | JFDNNGOCTUYAFB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|