C30H32N2O2 — CID 23404641
2-[4-[2-[4-[(4aS)-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl]phenyl]ethyl]anilino]benzoic acid (PubChem CID 23404641) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[4-[2-[4-[(4aS)-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl]phenyl]ethyl]anilino]benzoic acid.
| Compound Name | 2-[4-[2-[4-[(4aS)-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl]phenyl]ethyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 23404641 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[4-[2-[4-[(4aS)-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl]phenyl]ethyl]anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc(CCc2ccc(N3CC[C@@H]4CCCC=C4C3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O2/c33-30(34)28-7-3-4-8-29(28)31-26-15-11-22(12-16-26)9-10-23-13-17-27(18-14-23)32-20-19-24-5-1-2-6-25(24)21-32/h3-4,6-8,11-18,24,31H,1-2,5,9-10,19-21H2,(H,33,34)/t24-/m0/s1 |
| InChIKey | FJACNEIXILOJFJ-DEOSSOPVSA-N |
| XLogP | 6.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|