C11H22NO7P — CID 23413490
(2R,4aR,6S,7R,8R,8aR)-2,6,7,8-tetramethoxy-3-methyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3,2]oxazaphosphinine 2-oxide (PubChem CID 23413490) has the molecular formula C11H22NO7P and a molecular weight of 311.27 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aR)-2,6,7,8-tetramethoxy-3-methyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3,2]oxazaphosphinine 2-oxide.
| Compound Name | (2R,4aR,6S,7R,8R,8aR)-2,6,7,8-tetramethoxy-3-methyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3,2]oxazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 23413490 |
| Molecular Formula | C11H22NO7P |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aR)-2,6,7,8-tetramethoxy-3-methyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3,2]oxazaphosphinine 2-oxide |
| SMILES | CO[C@H]1O[C@@H]2CN(C)[P@@](=O)(OC)O[C@H]2[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C11H22NO7P/c1-12-6-7-8(19-20(12,13)17-5)9(14-2)10(15-3)11(16-4)18-7/h7-11H,6H2,1-5H3/t7-,8-,9+,10-,11+,20-/m1/s1 |
| InChIKey | ZIRCKKLZYBJYBR-AHBSQBMRSA-N |
| XLogP | 0.47 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|