C12H19N3O5 — CID 134838103
(1R,10R,11S,12R,13S)-11,12,13-trimethoxy-9,14-dioxa-3,4,5-triazatricyclo[8.4.0.03,7]tetradeca-4,6-diene (PubChem CID 134838103) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is (1R,10R,11S,12R,13S)-11,12,13-trimethoxy-9,14-dioxa-3,4,5-triazatricyclo[8.4.0.03,7]tetradeca-4,6-diene.
| Compound Name | (1R,10R,11S,12R,13S)-11,12,13-trimethoxy-9,14-dioxa-3,4,5-triazatricyclo[8.4.0.03,7]tetradeca-4,6-diene |
|---|---|
| PubChem CID | 134838103 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (1R,10R,11S,12R,13S)-11,12,13-trimethoxy-9,14-dioxa-3,4,5-triazatricyclo[8.4.0.03,7]tetradeca-4,6-diene |
| SMILES | CO[C@H]1O[C@@H]2Cn3nncc3CO[C@H]2[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C12H19N3O5/c1-16-10-9-8(20-12(18-3)11(10)17-2)5-15-7(6-19-9)4-13-14-15/h4,8-12H,5-6H2,1-3H3/t8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | JNXPKPUZKJHYOX-ZIQFBCGOSA-N |
| XLogP | -0.42 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |