C26H25Cl2NO2 — CID 2343566
(E)-3-(2,4-dichlorophenyl)-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]prop-2-enamide (PubChem CID 2343566) has the molecular formula C26H25Cl2NO2 and a molecular weight of 454.40 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2343566 |
| Molecular Formula | C26H25Cl2NO2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]prop-2-enamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)/C=C/c3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25Cl2NO2/c1-4-26(2,3)19-7-12-22(13-8-19)31-23-14-10-21(11-15-23)29-25(30)16-6-18-5-9-20(27)17-24(18)28/h5-17H,4H2,1-3H3,(H,29,30)/b16-6+ |
| InChIKey | HSKXMRKLIWNQKQ-OMCISZLKSA-N |
| XLogP | 8.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|