C24H27N3O5S2 — CID 23440688
4-[[2-(4-aminophenyl)-1-benzofuran-5-yl]sulfonyl]-2,2-dimethyl-N-prop-2-enoxythiomorpholine-3-carboxamide (PubChem CID 23440688) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 4-[[2-(4-aminophenyl)-1-benzofuran-5-yl]sulfonyl]-2,2-dimethyl-N-prop-2-enoxythiomorpholine-3-carboxamide.
| Compound Name | 4-[[2-(4-aminophenyl)-1-benzofuran-5-yl]sulfonyl]-2,2-dimethyl-N-prop-2-enoxythiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 23440688 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-[[2-(4-aminophenyl)-1-benzofuran-5-yl]sulfonyl]-2,2-dimethyl-N-prop-2-enoxythiomorpholine-3-carboxamide |
| SMILES | C=CCONC(=O)C1N(S(=O)(=O)c2ccc3oc(-c4ccc(N)cc4)cc3c2)CCSC1(C)C |
| InChI | InChI=1S/C24H27N3O5S2/c1-4-12-31-26-23(28)22-24(2,3)33-13-11-27(22)34(29,30)19-9-10-20-17(14-19)15-21(32-20)16-5-7-18(25)8-6-16/h4-10,14-15,22H,1,11-13,25H2,2-3H3,(H,26,28) |
| InChIKey | GGDHTGKVTADJFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|