C18H26ClNO — CID 23447932
4-[chloro(cyclohexyl)methyl]-N,N-diethylbenzamide (PubChem CID 23447932) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is 4-[chloro(cyclohexyl)methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[chloro(cyclohexyl)methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 23447932 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-[chloro(cyclohexyl)methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(Cl)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26ClNO/c1-3-20(4-2)18(21)16-12-10-15(11-13-16)17(19)14-8-6-5-7-9-14/h10-14,17H,3-9H2,1-2H3 |
| InChIKey | HQIYCQJCZAWXSZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|