C21H29N3O — CID 23453797
4-(2'-methyl-5-morpholin-4-ylspiro[3,4-dihydropyrrole-2,3'-bicyclo[2.2.1]heptane]-2'-yl)aniline (PubChem CID 23453797) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-(2'-methyl-5-morpholin-4-ylspiro[3,4-dihydropyrrole-2,3'-bicyclo[2.2.1]heptane]-2'-yl)aniline.
| Compound Name | 4-(2'-methyl-5-morpholin-4-ylspiro[3,4-dihydropyrrole-2,3'-bicyclo[2.2.1]heptane]-2'-yl)aniline |
|---|---|
| PubChem CID | 23453797 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 4-(2'-methyl-5-morpholin-4-ylspiro[3,4-dihydropyrrole-2,3'-bicyclo[2.2.1]heptane]-2'-yl)aniline |
| SMILES | CC1(c2ccc(N)cc2)C2CCC(C2)C12CCC(N1CCOCC1)=N2 |
| InChI | InChI=1S/C21H29N3O/c1-20(15-4-6-18(22)7-5-15)16-2-3-17(14-16)21(20)9-8-19(23-21)24-10-12-25-13-11-24/h4-7,16-17H,2-3,8-14,22H2,1H3 |
| InChIKey | NUHNPEBSMWYPQK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|