C17H9ClO4 — CID 23454353
4'-(3-chlorophenyl)spiro[2-benzofuran-3,2'-furan]-1,3'-dione (PubChem CID 23454353) has the molecular formula C17H9ClO4 and a molecular weight of 312.71 g/mol. Its IUPAC name is 4'-(3-chlorophenyl)spiro[2-benzofuran-3,2'-furan]-1,3'-dione.
| Compound Name | 4'-(3-chlorophenyl)spiro[2-benzofuran-3,2'-furan]-1,3'-dione |
|---|---|
| PubChem CID | 23454353 |
| Molecular Formula | C17H9ClO4 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4'-(3-chlorophenyl)spiro[2-benzofuran-3,2'-furan]-1,3'-dione |
| SMILES | O=C1OC2(OC=C(c3cccc(Cl)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C17H9ClO4/c18-11-5-3-4-10(8-11)13-9-21-17(15(13)19)14-7-2-1-6-12(14)16(20)22-17/h1-9H |
| InChIKey | SRLXNXVBFOVYIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |