About 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione
1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione (PubChem CID 23455312) has the molecular formula C17H22N4O5
and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione |
| PubChem CID | 23455312 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2c1ncn2C1CC(=O)CC(C)C(=O)O1 |
| InChI | InChI=1S/C17H22N4O5/c1-9(2)7-20-14-13(15(23)19(4)17(20)25)21(8-18-14)12-6-11(22)5-10(3)16(24)26-12/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | ZHIHHWSUCZUEBF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione?
The IUPAC name of 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione (CID 23455312) is 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione.
What is the SMILES notation for 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione?
The canonical SMILES for 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione is CC(C)Cn1c(=O)n(C)c(=O)c2c1ncn2C1CC(=O)CC(C)C(=O)O1.
What is the InChIKey of 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione?
The InChIKey is ZHIHHWSUCZUEBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O5/c1-9(2)7-20-14-13(15(23)19(4)17(20)25)21(8-18-14)12-6-11(22)5-10(3)16(24)26-12/h8-10,12H,5-7H2,1-4H3.
What are the key properties of 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione?
1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione has a molecular weight of 362.39 g/mol, XLogP of 0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-(6-methyl-4,7-dioxooxepan-2-yl)-3-(2-methylpropyl)purine-2,6-dione is sourced from PubChem (CID 23455312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).