C11H12N4O4 — CID 40656548
1,3-dimethyl-7-[(3R)-2-oxooxolan-3-yl]purine-2,6-dione (PubChem CID 40656548) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 1,3-dimethyl-7-[(3R)-2-oxooxolan-3-yl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[(3R)-2-oxooxolan-3-yl]purine-2,6-dione |
|---|---|
| PubChem CID | 40656548 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1,3-dimethyl-7-[(3R)-2-oxooxolan-3-yl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2[C@@H]2CCOC2=O)n(C)c1=O |
| InChI | InChI=1S/C11H12N4O4/c1-13-8-7(9(16)14(2)11(13)18)15(5-12-8)6-3-4-19-10(6)17/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | RSUOBGMVCHIHCS-ZCFIWIBFSA-N |
| XLogP | -1.08 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |