C16H19NO3S — CID 23462916
6-(furan-2-ylmethylsulfanyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol (PubChem CID 23462916) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 6-(furan-2-ylmethylsulfanyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol.
| Compound Name | 6-(furan-2-ylmethylsulfanyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 23462916 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 6-(furan-2-ylmethylsulfanyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| SMILES | CN1CCc2cc(O)c(O)c(SCc3ccco3)c2CC1 |
| InChI | InChI=1S/C16H19NO3S/c1-17-6-4-11-9-14(18)15(19)16(13(11)5-7-17)21-10-12-3-2-8-20-12/h2-3,8-9,18-19H,4-7,10H2,1H3 |
| InChIKey | CRLDMXQTJUVMRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|