C22H23Cl2NO3 — CID 12909791
9-chloro-3-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride (PubChem CID 12909791) has the molecular formula C22H23Cl2NO3 and a molecular weight of 420.34 g/mol. Its IUPAC name is 9-chloro-3-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride.
| Compound Name | 9-chloro-3-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride |
|---|---|
| PubChem CID | 12909791 |
| Molecular Formula | C22H23Cl2NO3 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 9-chloro-3-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride |
| SMILES | Cc1cccc(C2CN(Cc3ccco3)CCc3c2cc(O)c(O)c3Cl)c1.Cl |
| InChI | InChI=1S/C22H22ClNO3.ClH/c1-14-4-2-5-15(10-14)19-13-24(12-16-6-3-9-27-16)8-7-17-18(19)11-20(25)22(26)21(17)23;/h2-6,9-11,19,25-26H,7-8,12-13H2,1H3;1H |
| InChIKey | VDVKLQDMWNDGKL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|