C28H21N5O4 — CID 23482279
N'-(6-naphthalen-2-yloxy-5-nitropyrimidin-4-yl)-2,2-diphenylacetohydrazide (PubChem CID 23482279) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is N'-(6-naphthalen-2-yloxy-5-nitropyrimidin-4-yl)-2,2-diphenylacetohydrazide.
| Compound Name | N'-(6-naphthalen-2-yloxy-5-nitropyrimidin-4-yl)-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 23482279 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N'-(6-naphthalen-2-yloxy-5-nitropyrimidin-4-yl)-2,2-diphenylacetohydrazide |
| SMILES | O=C(NNc1ncnc(Oc2ccc3ccccc3c2)c1[N+](=O)[O-])C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21N5O4/c34-27(24(20-10-3-1-4-11-20)21-12-5-2-6-13-21)32-31-26-25(33(35)36)28(30-18-29-26)37-23-16-15-19-9-7-8-14-22(19)17-23/h1-18,24H,(H,32,34)(H,29,30,31) |
| InChIKey | DAVXJIGAWZCONU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|