C32H39N3O3 — CID 23506738
N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-4-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]butan-1-amine (PubChem CID 23506738) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-4-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]butan-1-amine.
| Compound Name | N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-4-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]butan-1-amine |
|---|---|
| PubChem CID | 23506738 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-4-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]butan-1-amine |
| SMILES | COc1cc(CNCCCCc2cc(C)cc(-n3c(C)ccc3C)n2)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C32H39N3O3/c1-23-17-28(34-32(18-23)35-24(2)14-15-25(35)3)13-9-10-16-33-21-27-19-30(36-4)31(37-5)20-29(27)38-22-26-11-7-6-8-12-26/h6-8,11-12,14-15,17-20,33H,9-10,13,16,21-22H2,1-5H3 |
| InChIKey | ZEEXSDMNGBPLID-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|