C19H20N2O4 — CID 68693296
N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-1,2-oxazol-3-amine (PubChem CID 68693296) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-1,2-oxazol-3-amine.
| Compound Name | N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 68693296 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methyl]-1,2-oxazol-3-amine |
| SMILES | COc1cc(CNc2ccon2)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H20N2O4/c1-22-17-10-15(12-20-19-8-9-25-21-19)16(11-18(17)23-2)24-13-14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3,(H,20,21) |
| InChIKey | KCTXRZBEZRJTPT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |