C25H32N2O5 — CID 23517643
bis[2-(3,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl] carbonate (PubChem CID 23517643) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is bis[2-(3,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl] carbonate.
| Compound Name | bis[2-(3,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 23517643 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | bis[2-(3,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl] carbonate |
| SMILES | Cc1ccc2c(c1)N(CCOC(=O)OCCN1c3cc(C)ccc3OCC1C)C(C)CO2 |
| InChI | InChI=1S/C25H32N2O5/c1-17-5-7-23-21(13-17)26(19(3)15-31-23)9-11-29-25(28)30-12-10-27-20(4)16-32-24-8-6-18(2)14-22(24)27/h5-8,13-14,19-20H,9-12,15-16H2,1-4H3 |
| InChIKey | GFIVOYZFFQEPDF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |