C29H36F2N2O8 — CID 23525552
8-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetyl]-3-[3-(3,4,5-trimethoxyphenyl)propyl]-3,8-diazabicyclo[3.2.1]octan-2-one (PubChem CID 23525552) has the molecular formula C29H36F2N2O8 and a molecular weight of 578.61 g/mol. Its IUPAC name is 8-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetyl]-3-[3-(3,4,5-trimethoxyphenyl)propyl]-3,8-diazabicyclo[3.2.1]octan-2-one.
| Compound Name | 8-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetyl]-3-[3-(3,4,5-trimethoxyphenyl)propyl]-3,8-diazabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 23525552 |
| Molecular Formula | C29H36F2N2O8 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 8-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetyl]-3-[3-(3,4,5-trimethoxyphenyl)propyl]-3,8-diazabicyclo[3.2.1]octan-2-one |
| SMILES | COc1cc(CCCN2CC3CCC(C2=O)N3C(=O)C(F)(F)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H36F2N2O8/c1-36-21-12-17(13-22(37-2)25(21)40-5)8-7-11-32-16-19-9-10-20(27(32)34)33(19)28(35)29(30,31)18-14-23(38-3)26(41-6)24(15-18)39-4/h12-15,19-20H,7-11,16H2,1-6H3 |
| InChIKey | PGLFWBZFANRXNT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |