C11H16N3O7-3 — CID 23526104
2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-(methylamino)-2-oxoethyl]amino]acetate (PubChem CID 23526104) has the molecular formula C11H16N3O7-3 and a molecular weight of 302.26 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-(methylamino)-2-oxoethyl]amino]acetate.
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-(methylamino)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 23526104 |
| Molecular Formula | C11H16N3O7-3 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-(methylamino)-2-oxoethyl]amino]acetate |
| SMILES | CNC(=O)CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C11H19N3O7/c1-12-8(15)4-13(5-9(16)17)2-3-14(6-10(18)19)7-11(20)21/h2-7H2,1H3,(H,12,15)(H,16,17)(H,18,19)(H,20,21)/p-3 |
| InChIKey | ZPYJATAERXMSTB-UHFFFAOYSA-K |
| XLogP | -6.41 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | -6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |