C39H16F10N4 — CID 23527824
14-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaene (PubChem CID 23527824) has the molecular formula C39H16F10N4 and a molecular weight of 730.56 g/mol. Its IUPAC name is 14-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaene.
| Compound Name | 14-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaene |
|---|---|
| PubChem CID | 23527824 |
| Molecular Formula | C39H16F10N4 |
| Molecular Weight | 730.56 g/mol |
| Exact Mass | 730.12 |
| IUPAC Name | 14-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaene |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccc(N4c5ccccc5-c5ccccc5-c5ccccc54)cc3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C39H16F10N4/c40-27-25(28(41)32(45)35(48)31(27)44)38-50-37(51-39(52-38)26-29(42)33(46)36(49)34(47)30(26)43)17-13-15-18(16-14-17)53-23-11-5-3-9-21(23)19-7-1-2-8-20(19)22-10-4-6-12-24(22)53/h1-16H |
| InChIKey | XQMZZBGPYOKBDQ-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.56 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|