About benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine
benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 23528036) has the molecular formula C23H15F3N2Pt
and a molecular weight of 571.46 g/mol. Its IUPAC name is benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
Molecular Properties
| Compound Name | benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| PubChem CID | 23528036 |
| Molecular Formula | C23H15F3N2Pt |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | FC(F)(F)c1c[c-]c(-c2cccc(-c3ccccn3)n2)cc1.[Pt+2].[c-]1ccccc1 |
| InChI | InChI=1S/C17H10F3N2.C6H5.Pt/c18-17(19,20)13-9-7-12(8-10-13)14-5-3-6-16(22-14)15-4-1-2-11-21-15;1-2-4-6-5-3-1;/h1-7,9-11H;1-5H;/q2*-1;+2 |
| InChIKey | NWMURHLKXVZRON-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The IUPAC name of benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (CID 23528036) is benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
What is the SMILES notation for benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The canonical SMILES for benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine is FC(F)(F)c1c[c-]c(-c2cccc(-c3ccccn3)n2)cc1.[Pt+2].[c-]1ccccc1.
What is the InChIKey of benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The InChIKey is NWMURHLKXVZRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3N2.C6H5.Pt/c18-17(19,20)13-9-7-12(8-10-13)14-5-3-6-16(22-14)15-4-1-2-11-21-15;1-2-4-6-5-3-1;/h1-7,9-11H;1-5H;/q2*-1;+2.
What are the key properties of benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine has a molecular weight of 571.46 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;platinum(2+);2-pyridin-2-yl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine is sourced from PubChem (CID 23528036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).