C10H10N3Y+2 — CID 23541593
1,4-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium(3+) (PubChem CID 23541593) has the molecular formula C10H10N3Y+2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 1,4-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium(3+).
| Compound Name | 1,4-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium(3+) |
|---|---|
| PubChem CID | 23541593 |
| Molecular Formula | C10H10N3Y+2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 1,4-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium(3+) |
| SMILES | C=c1ccnc2c1=C(C)N=[C-]N2C.[Y+3] |
| InChI | InChI=1S/C10H10N3.Y/c1-7-4-5-11-10-9(7)8(2)12-6-13(10)3;/h4-5H,1H2,2-3H3;/q-1;+3 |
| InChIKey | PEYLWDCMRSHNEW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|