C16H25NO4 — CID 23549389
N,2,4-trihydroxy-N-propan-2-yl-3,5-dipropylbenzamide (PubChem CID 23549389) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is N,2,4-trihydroxy-N-propan-2-yl-3,5-dipropylbenzamide.
| Compound Name | N,2,4-trihydroxy-N-propan-2-yl-3,5-dipropylbenzamide |
|---|---|
| PubChem CID | 23549389 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N,2,4-trihydroxy-N-propan-2-yl-3,5-dipropylbenzamide |
| SMILES | CCCc1cc(C(=O)N(O)C(C)C)c(O)c(CCC)c1O |
| InChI | InChI=1S/C16H25NO4/c1-5-7-11-9-13(16(20)17(21)10(3)4)15(19)12(8-6-2)14(11)18/h9-10,18-19,21H,5-8H2,1-4H3 |
| InChIKey | CZCWZKLERCNPQD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|