C13H13NO — CID 23557927
6,7-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene (PubChem CID 23557927) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 6,7-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene.
| Compound Name | 6,7-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene |
|---|---|
| PubChem CID | 23557927 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 6,7-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene |
| SMILES | Cc1nc2cccc3c2c(c1C)CCO3 |
| InChI | InChI=1S/C13H13NO/c1-8-9(2)14-11-4-3-5-12-13(11)10(8)6-7-15-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | JWTUXTPWTXFSRA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |