C21H18N2O2 — CID 2355957
N'-(2,2-diphenylethenyl)-4-hydroxybenzohydrazide (PubChem CID 2355957) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-(2,2-diphenylethenyl)-4-hydroxybenzohydrazide.
| Compound Name | N'-(2,2-diphenylethenyl)-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 2355957 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N'-(2,2-diphenylethenyl)-4-hydroxybenzohydrazide |
| SMILES | O=C(NNC=C(c1ccccc1)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H18N2O2/c24-19-13-11-18(12-14-19)21(25)23-22-15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,22,24H,(H,23,25) |
| InChIKey | PPWNJMCZGKSLMK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|