C24H25Cl3N2O7 — CID 23574474
2,2,2-trichloroethyl (6S,6aS)-6-hydroxy-2,4-dimethoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 23574474) has the molecular formula C24H25Cl3N2O7 and a molecular weight of 559.83 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S,6aS)-6-hydroxy-2,4-dimethoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S,6aS)-6-hydroxy-2,4-dimethoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 23574474 |
| Molecular Formula | C24H25Cl3N2O7 |
| Molecular Weight | 559.83 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | 2,2,2-trichloroethyl (6S,6aS)-6-hydroxy-2,4-dimethoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COc1cc2c(c(OC)c1OCc1ccccc1)N(C(=O)OCC(Cl)(Cl)Cl)[C@@H](O)[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C24H25Cl3N2O7/c1-33-17-11-15-18(20(34-2)19(17)35-12-14-7-4-3-5-8-14)29(23(32)36-13-24(25,26)27)22(31)16-9-6-10-28(16)21(15)30/h3-5,7-8,11,16,22,31H,6,9-10,12-13H2,1-2H3/t16-,22-/m0/s1 |
| InChIKey | FONKAZVLQHYWOO-AOMKIAJQSA-N |
| XLogP | 4.53 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|