C19H22F6N3O6P — CID 23574880
[8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-methyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl]phosphonic acid (PubChem CID 23574880) has the molecular formula C19H22F6N3O6P and a molecular weight of 533.36 g/mol. Its IUPAC name is [8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-methyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl]phosphonic acid.
| Compound Name | [8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-methyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 23574880 |
| Molecular Formula | C19H22F6N3O6P |
| Molecular Weight | 533.36 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | [8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-methyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl]phosphonic acid |
| SMILES | CC(OCC1(C)CCC2(CN1)NC(=O)N(P(=O)(O)O)C2=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F6N3O6P/c1-10(11-5-12(18(20,21)22)7-13(6-11)19(23,24)25)34-9-16(2)3-4-17(8-26-16)14(29)28(15(30)27-17)35(31,32)33/h5-7,10,26H,3-4,8-9H2,1-2H3,(H,27,30)(H2,31,32,33) |
| InChIKey | RARGLXTWCNRNNU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|