C12H17CrNO — CID 23578309
chromium;2,4-dimethyl-6-(2-methylpropylideneamino)phenol (PubChem CID 23578309) has the molecular formula C12H17CrNO and a molecular weight of 243.27 g/mol. Its IUPAC name is chromium;2,4-dimethyl-6-(2-methylpropylideneamino)phenol.
| Compound Name | chromium;2,4-dimethyl-6-(2-methylpropylideneamino)phenol |
|---|---|
| PubChem CID | 23578309 |
| Molecular Formula | C12H17CrNO |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | chromium;2,4-dimethyl-6-(2-methylpropylideneamino)phenol |
| SMILES | Cc1cc(C)c(O)c(/N=C/C(C)C)c1.[Cr] |
| InChI | InChI=1S/C12H17NO.Cr/c1-8(2)7-13-11-6-9(3)5-10(4)12(11)14;/h5-8,14H,1-4H3;/b13-7+; |
| InChIKey | CBWDANQUHIDKDB-FTPOTTDRSA-N |
| XLogP | 3.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|