C24H21ClN4O6 — CID 23582112
benzyl (2S)-2-[[3-[(5-chloro-3-pyridinyl)oxy]-5-nitrophenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582112) has the molecular formula C24H21ClN4O6 and a molecular weight of 496.91 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-[(5-chloro-3-pyridinyl)oxy]-5-nitrophenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[3-[(5-chloro-3-pyridinyl)oxy]-5-nitrophenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582112 |
| Molecular Formula | C24H21ClN4O6 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | benzyl (2S)-2-[[3-[(5-chloro-3-pyridinyl)oxy]-5-nitrophenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1cc(Oc2cncc(Cl)c2)cc([N+](=O)[O-])c1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H21ClN4O6/c25-17-9-21(14-26-13-17)35-20-11-18(10-19(12-20)29(32)33)27-23(30)22-7-4-8-28(22)24(31)34-15-16-5-2-1-3-6-16/h1-3,5-6,9-14,22H,4,7-8,15H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | NKDOBDALHRJDKV-QFIPXVFZSA-N |
| XLogP | 5.18 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|