C31H29N3O7 — CID 23582747
benzyl (2S)-2-[[3-nitro-5-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582747) has the molecular formula C31H29N3O7 and a molecular weight of 555.59 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-nitro-5-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[3-nitro-5-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582747 |
| Molecular Formula | C31H29N3O7 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | benzyl (2S)-2-[[3-nitro-5-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1cc(Oc2ccc3oc4c(c3c2)CCCC4)cc([N+](=O)[O-])c1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H29N3O7/c35-30(27-10-6-14-33(27)31(36)39-19-20-7-2-1-3-8-20)32-21-15-22(34(37)38)17-24(16-21)40-23-12-13-29-26(18-23)25-9-4-5-11-28(25)41-29/h1-3,7-8,12-13,15-18,27H,4-6,9-11,14,19H2,(H,32,35)/t27-/m0/s1 |
| InChIKey | OCVPXLJGUWEZSG-MHZLTWQESA-N |
| XLogP | 6.75 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|