C19H21FN4O — CID 23582128
1-(cyclohexylmethylamino)-8-fluoro-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 23582128) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-(cyclohexylmethylamino)-8-fluoro-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-(cyclohexylmethylamino)-8-fluoro-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 23582128 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-(cyclohexylmethylamino)-8-fluoro-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cnc(NCC2CCCCC2)c2c1[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C19H21FN4O/c20-12-6-7-15-13(8-12)16-17(24-15)14(18(21)25)10-23-19(16)22-9-11-4-2-1-3-5-11/h6-8,10-11,24H,1-5,9H2,(H2,21,25)(H,22,23) |
| InChIKey | JRJBDVPELPFCKJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |