C17H14F3IN4O — CID 59543146
1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-7-iodo-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 59543146) has the molecular formula C17H14F3IN4O and a molecular weight of 474.22 g/mol. Its IUPAC name is 1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-7-iodo-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-7-iodo-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 59543146 |
| Molecular Formula | C17H14F3IN4O |
| Molecular Weight | 474.22 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-7-iodo-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cnc(N[C@H](C2CC2)C(F)(F)F)c2c1[nH]c1cc(I)ccc12 |
| InChI | InChI=1S/C17H14F3IN4O/c18-17(19,20)14(7-1-2-7)25-16-12-9-4-3-8(21)5-11(9)24-13(12)10(6-23-16)15(22)26/h3-7,14,24H,1-2H2,(H2,22,26)(H,23,25)/t14-/m1/s1 |
| InChIKey | FPYJTFQETAXYJC-CQSZACIVSA-N |
| XLogP | 4.17 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|